C22H21Cl2FN4O3 — CID 166538617
tert-butyl 3-[4-(3,4-dichloro-2-fluoroanilino)quinazolin-6-yl]-3-hydroxyazetidine-1-carboxylate (PubChem CID 166538617) has the molecular formula C22H21Cl2FN4O3 and a molecular weight of 479.34 g/mol. Its IUPAC name is tert-butyl 3-[4-(3,4-dichloro-2-fluoroanilino)quinazolin-6-yl]-3-hydroxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(3,4-dichloro-2-fluoroanilino)quinazolin-6-yl]-3-hydroxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 166538617 |
| Molecular Formula | C22H21Cl2FN4O3 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | tert-butyl 3-[4-(3,4-dichloro-2-fluoroanilino)quinazolin-6-yl]-3-hydroxyazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(c2ccc3ncnc(Nc4ccc(Cl)c(Cl)c4F)c3c2)C1 |
| InChI | InChI=1S/C22H21Cl2FN4O3/c1-21(2,3)32-20(30)29-9-22(31,10-29)12-4-6-15-13(8-12)19(27-11-26-15)28-16-7-5-14(23)17(24)18(16)25/h4-8,11,31H,9-10H2,1-3H3,(H,26,27,28) |
| InChIKey | BVHVBDQFTOILHR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|