C18H14Cl2F2N4 — CID 166539742
N-(3,4-dichloro-2-fluorophenyl)-6-[(3S)-3-fluoropyrrolidin-3-yl]quinazolin-4-amine (PubChem CID 166539742) has the molecular formula C18H14Cl2F2N4 and a molecular weight of 395.24 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-6-[(3S)-3-fluoropyrrolidin-3-yl]quinazolin-4-amine.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-6-[(3S)-3-fluoropyrrolidin-3-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 166539742 |
| Molecular Formula | C18H14Cl2F2N4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-6-[(3S)-3-fluoropyrrolidin-3-yl]quinazolin-4-amine |
| SMILES | Fc1c(Nc2ncnc3ccc([C@@]4(F)CCNC4)cc23)ccc(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl2F2N4/c19-12-2-4-14(16(21)15(12)20)26-17-11-7-10(18(22)5-6-23-8-18)1-3-13(11)24-9-25-17/h1-4,7,9,23H,5-6,8H2,(H,24,25,26)/t18-/m1/s1 |
| InChIKey | HJBHAHDBFVSZBK-GOSISDBHSA-N |
| XLogP | 4.98 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|