C14H7Cl3F2N4O2 — CID 44542523
N-(3,4-dichloro-2-fluorophenyl)-7-fluoro-6-nitroquinazolin-4-amine;hydrochloride (PubChem CID 44542523) has the molecular formula C14H7Cl3F2N4O2 and a molecular weight of 407.59 g/mol. Its IUPAC name is N-(3,4-dichloro-2-fluorophenyl)-7-fluoro-6-nitroquinazolin-4-amine;hydrochloride.
| Compound Name | N-(3,4-dichloro-2-fluorophenyl)-7-fluoro-6-nitroquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 44542523 |
| Molecular Formula | C14H7Cl3F2N4O2 |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | N-(3,4-dichloro-2-fluorophenyl)-7-fluoro-6-nitroquinazolin-4-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc2c(Nc3ccc(Cl)c(Cl)c3F)ncnc2cc1F |
| InChI | InChI=1S/C14H6Cl2F2N4O2.ClH/c15-7-1-2-9(13(18)12(7)16)21-14-6-3-11(22(23)24)8(17)4-10(6)19-5-20-14;/h1-5H,(H,19,20,21);1H |
| InChIKey | FWDGHIQJANBPDT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|