C16H12BrClFN5O3 — CID 69100203
7-(2-aminoethoxy)-N-(4-bromo-3-chloro-2-fluorophenyl)-6-nitroquinazolin-4-amine (PubChem CID 69100203) has the molecular formula C16H12BrClFN5O3 and a molecular weight of 456.66 g/mol. Its IUPAC name is 7-(2-aminoethoxy)-N-(4-bromo-3-chloro-2-fluorophenyl)-6-nitroquinazolin-4-amine.
| Compound Name | 7-(2-aminoethoxy)-N-(4-bromo-3-chloro-2-fluorophenyl)-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 69100203 |
| Molecular Formula | C16H12BrClFN5O3 |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | 7-(2-aminoethoxy)-N-(4-bromo-3-chloro-2-fluorophenyl)-6-nitroquinazolin-4-amine |
| SMILES | NCCOc1cc2ncnc(Nc3ccc(Br)c(Cl)c3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12BrClFN5O3/c17-9-1-2-10(15(19)14(9)18)23-16-8-5-12(24(25)26)13(27-4-3-20)6-11(8)21-7-22-16/h1-2,5-7H,3-4,20H2,(H,21,22,23) |
| InChIKey | RALYTZQPDDIMHJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|