C22H23BrF2N6O4 — CID 69101264
N-[2-[4-(4-bromo-2,3-difluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl]-4-(dimethylamino)butanamide (PubChem CID 69101264) has the molecular formula C22H23BrF2N6O4 and a molecular weight of 553.36 g/mol. Its IUPAC name is N-[2-[4-(4-bromo-2,3-difluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl]-4-(dimethylamino)butanamide.
| Compound Name | N-[2-[4-(4-bromo-2,3-difluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl]-4-(dimethylamino)butanamide |
|---|---|
| PubChem CID | 69101264 |
| Molecular Formula | C22H23BrF2N6O4 |
| Molecular Weight | 553.36 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | N-[2-[4-(4-bromo-2,3-difluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl]-4-(dimethylamino)butanamide |
| SMILES | CN(C)CCCC(=O)NCCOc1cc2ncnc(Nc3ccc(Br)c(F)c3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23BrF2N6O4/c1-30(2)8-3-4-19(32)26-7-9-35-18-11-16-13(10-17(18)31(33)34)22(28-12-27-16)29-15-6-5-14(23)20(24)21(15)25/h5-6,10-12H,3-4,7-9H2,1-2H3,(H,26,32)(H,27,28,29) |
| InChIKey | FUZXGDMUCWDVEX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|