C21H20BrClFN5O5 — CID 91012570
tert-butyl N-[2-[4-(4-bromo-3-chloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl]carbamate (PubChem CID 91012570) has the molecular formula C21H20BrClFN5O5 and a molecular weight of 556.78 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-bromo-3-chloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4-bromo-3-chloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 91012570 |
| Molecular Formula | C21H20BrClFN5O5 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | tert-butyl N-[2-[4-(4-bromo-3-chloro-2-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cc2ncnc(Nc3ccc(Br)c(Cl)c3F)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20BrClFN5O5/c1-21(2,3)34-20(30)25-6-7-33-16-9-14-11(8-15(16)29(31)32)19(27-10-26-14)28-13-5-4-12(22)17(23)18(13)24/h4-5,8-10H,6-7H2,1-3H3,(H,25,30)(H,26,27,28) |
| InChIKey | NSEJJTOXNDQWNI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|