C23H26ClN5O7 — CID 91019797
tert-butyl N-[2-[4-(4-chloro-2,5-dimethoxyanilino)-6-nitroquinazolin-7-yl]oxyethyl]carbamate (PubChem CID 91019797) has the molecular formula C23H26ClN5O7 and a molecular weight of 519.94 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-chloro-2,5-dimethoxyanilino)-6-nitroquinazolin-7-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4-chloro-2,5-dimethoxyanilino)-6-nitroquinazolin-7-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 91019797 |
| Molecular Formula | C23H26ClN5O7 |
| Molecular Weight | 519.94 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | tert-butyl N-[2-[4-(4-chloro-2,5-dimethoxyanilino)-6-nitroquinazolin-7-yl]oxyethyl]carbamate |
| SMILES | COc1cc(Nc2ncnc3cc(OCCNC(=O)OC(C)(C)C)c([N+](=O)[O-])cc23)c(OC)cc1Cl |
| InChI | InChI=1S/C23H26ClN5O7/c1-23(2,3)36-22(30)25-6-7-35-20-10-15-13(8-17(20)29(31)32)21(27-12-26-15)28-16-11-18(33-4)14(24)9-19(16)34-5/h8-12H,6-7H2,1-5H3,(H,25,30)(H,26,27,28) |
| InChIKey | ASPJAZOTLUBMBJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|