C25H29ClFN5O6 — CID 21345330
tert-butyl 2-[2-[4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl-[(2R)-2-hydroxypropyl]amino]acetate (PubChem CID 21345330) has the molecular formula C25H29ClFN5O6 and a molecular weight of 549.99 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl-[(2R)-2-hydroxypropyl]amino]acetate.
| Compound Name | tert-butyl 2-[2-[4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl-[(2R)-2-hydroxypropyl]amino]acetate |
|---|---|
| PubChem CID | 21345330 |
| Molecular Formula | C25H29ClFN5O6 |
| Molecular Weight | 549.99 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | tert-butyl 2-[2-[4-(3-chloro-4-fluoroanilino)-6-nitroquinazolin-7-yl]oxyethyl-[(2R)-2-hydroxypropyl]amino]acetate |
| SMILES | C[C@@H](O)CN(CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1[N+](=O)[O-])CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H29ClFN5O6/c1-15(33)12-31(13-23(34)38-25(2,3)4)7-8-37-22-11-20-17(10-21(22)32(35)36)24(29-14-28-20)30-16-5-6-19(27)18(26)9-16/h5-6,9-11,14-15,33H,7-8,12-13H2,1-4H3,(H,28,29,30)/t15-/m1/s1 |
| InChIKey | HIABGPKLUWWULM-OAHLLOKOSA-N |
| XLogP | 4.48 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.99 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|