C18H17ClFIN4O — CID 147828198
N-(3-chloro-4-fluorophenyl)-7-[2-(dimethylamino)ethoxy]-6-iodoquinazolin-4-amine (PubChem CID 147828198) has the molecular formula C18H17ClFIN4O and a molecular weight of 486.72 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-[2-(dimethylamino)ethoxy]-6-iodoquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-[2-(dimethylamino)ethoxy]-6-iodoquinazolin-4-amine |
|---|---|
| PubChem CID | 147828198 |
| Molecular Formula | C18H17ClFIN4O |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.01 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-[2-(dimethylamino)ethoxy]-6-iodoquinazolin-4-amine |
| SMILES | CN(C)CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1I |
| InChI | InChI=1S/C18H17ClFIN4O/c1-25(2)5-6-26-17-9-16-12(8-15(17)21)18(23-10-22-16)24-11-3-4-14(20)13(19)7-11/h3-4,7-10H,5-6H2,1-2H3,(H,22,23,24) |
| InChIKey | HQOKKJKJBZENKB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|