C17H13ClF3N3O3 — CID 137150071
4-(3-chloro-4-fluoroanilino)-6-[2-(difluoromethoxy)ethoxy]quinazolin-7-ol (PubChem CID 137150071) has the molecular formula C17H13ClF3N3O3 and a molecular weight of 399.76 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-6-[2-(difluoromethoxy)ethoxy]quinazolin-7-ol.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-6-[2-(difluoromethoxy)ethoxy]quinazolin-7-ol |
|---|---|
| PubChem CID | 137150071 |
| Molecular Formula | C17H13ClF3N3O3 |
| Molecular Weight | 399.76 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-6-[2-(difluoromethoxy)ethoxy]quinazolin-7-ol |
| SMILES | Oc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCOC(F)F |
| InChI | InChI=1S/C17H13ClF3N3O3/c18-11-5-9(1-2-12(11)19)24-16-10-6-15(26-3-4-27-17(20)21)14(25)7-13(10)22-8-23-16/h1-2,5-8,17,25H,3-4H2,(H,22,23,24) |
| InChIKey | ZOVIQNBSIYOHGF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.76 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|