C21H19F6N3O4 — CID 134271519
6,7-bis[2-(difluoromethoxy)ethoxy]-N-(2,6-difluoro-4-methylphenyl)quinazolin-4-amine (PubChem CID 134271519) has the molecular formula C21H19F6N3O4 and a molecular weight of 491.39 g/mol. Its IUPAC name is 6,7-bis[2-(difluoromethoxy)ethoxy]-N-(2,6-difluoro-4-methylphenyl)quinazolin-4-amine.
| Compound Name | 6,7-bis[2-(difluoromethoxy)ethoxy]-N-(2,6-difluoro-4-methylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 134271519 |
| Molecular Formula | C21H19F6N3O4 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 6,7-bis[2-(difluoromethoxy)ethoxy]-N-(2,6-difluoro-4-methylphenyl)quinazolin-4-amine |
| SMILES | Cc1cc(F)c(Nc2ncnc3cc(OCCOC(F)F)c(OCCOC(F)F)cc23)c(F)c1 |
| InChI | InChI=1S/C21H19F6N3O4/c1-11-6-13(22)18(14(23)7-11)30-19-12-8-16(31-2-4-33-20(24)25)17(9-15(12)28-10-29-19)32-3-5-34-21(26)27/h6-10,20-21H,2-5H2,1H3,(H,28,29,30) |
| InChIKey | QUTYIKDENAIYBS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|