C25H30ClF2N5O3 — CID 144516017
N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-[2-(dimethylamino)ethoxy]-2-fluoro-3-methylbutanamide (PubChem CID 144516017) has the molecular formula C25H30ClF2N5O3 and a molecular weight of 522.00 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-[2-(dimethylamino)ethoxy]-2-fluoro-3-methylbutanamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-[2-(dimethylamino)ethoxy]-2-fluoro-3-methylbutanamide |
|---|---|
| PubChem CID | 144516017 |
| Molecular Formula | C25H30ClF2N5O3 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-[2-(dimethylamino)ethoxy]-2-fluoro-3-methylbutanamide |
| SMILES | CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C(F)C(C)COCCN(C)C |
| InChI | InChI=1S/C25H30ClF2N5O3/c1-5-36-22-12-20-17(24(30-14-29-20)31-16-6-7-19(27)18(26)10-16)11-21(22)32-25(34)23(28)15(2)13-35-9-8-33(3)4/h6-7,10-12,14-15,23H,5,8-9,13H2,1-4H3,(H,32,34)(H,29,30,31) |
| InChIKey | LXEPGWOSSCTDIF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|