C21H20ClFN4O4S2 — CID 135236511
N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-2-(1,1-dioxodithiolan-3-yl)acetamide (PubChem CID 135236511) has the molecular formula C21H20ClFN4O4S2 and a molecular weight of 511.00 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-2-(1,1-dioxodithiolan-3-yl)acetamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-2-(1,1-dioxodithiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 135236511 |
| Molecular Formula | C21H20ClFN4O4S2 |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-2-(1,1-dioxodithiolan-3-yl)acetamide |
| SMILES | CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)CC1CCS(=O)(=O)S1 |
| InChI | InChI=1S/C21H20ClFN4O4S2/c1-2-31-19-10-17-14(9-18(19)27-20(28)8-13-5-6-33(29,30)32-13)21(25-11-24-17)26-12-3-4-16(23)15(22)7-12/h3-4,7,9-11,13H,2,5-6,8H2,1H3,(H,27,28)(H,24,25,26) |
| InChIKey | BOTHKFCWLJNHMN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|