C21H20ClFN4O6S2 — CID 135237098
N-[4-(3-chloro-4-fluoroanilino)-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-1,1-dioxodithiolane-3-carboxamide (PubChem CID 135237098) has the molecular formula C21H20ClFN4O6S2 and a molecular weight of 543.00 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-1,1-dioxodithiolane-3-carboxamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-1,1-dioxodithiolane-3-carboxamide |
|---|---|
| PubChem CID | 135237098 |
| Molecular Formula | C21H20ClFN4O6S2 |
| Molecular Weight | 543.00 g/mol |
| Exact Mass | 542.05 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-1,1-dioxodithiolane-3-carboxamide |
| SMILES | O=C(Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OCC(O)CO)C1CCS(=O)(=O)S1 |
| InChI | InChI=1S/C21H20ClFN4O6S2/c22-14-5-11(1-2-15(14)23)26-20-13-6-17(27-21(30)19-3-4-35(31,32)34-19)18(33-9-12(29)8-28)7-16(13)24-10-25-20/h1-2,5-7,10,12,19,28-29H,3-4,8-9H2,(H,27,30)(H,24,25,26) |
| InChIKey | GUDZGOFMYVRNKC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 150.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.00 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|