C29H28ClFN4O5S2 — CID 135236979
N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-2-(dithiolan-3-yl)acetamide (PubChem CID 135236979) has the molecular formula C29H28ClFN4O5S2 and a molecular weight of 631.15 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-2-(dithiolan-3-yl)acetamide.
| Compound Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-2-(dithiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 135236979 |
| Molecular Formula | C29H28ClFN4O5S2 |
| Molecular Weight | 631.15 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-(2,3-dihydroxypropoxy)quinazolin-6-yl]-2-(dithiolan-3-yl)acetamide |
| SMILES | O=C(CC1CCSS1)Nc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2cc1OCC(O)CO |
| InChI | InChI=1S/C29H28ClFN4O5S2/c30-23-9-19(4-5-26(23)39-14-17-2-1-3-18(31)8-17)34-29-22-11-25(35-28(38)10-21-6-7-41-42-21)27(40-15-20(37)13-36)12-24(22)32-16-33-29/h1-5,8-9,11-12,16,20-21,36-37H,6-7,10,13-15H2,(H,35,38)(H,32,33,34) |
| InChIKey | GVUYVCUNUYVIJO-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.15 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|