C27H26ClFN4O6S3 — CID 135236823
N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-1-(2,2-dioxodithiolan-3-yl)methanesulfonamide (PubChem CID 135236823) has the molecular formula C27H26ClFN4O6S3 and a molecular weight of 653.18 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-1-(2,2-dioxodithiolan-3-yl)methanesulfonamide.
| Compound Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-1-(2,2-dioxodithiolan-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 135236823 |
| Molecular Formula | C27H26ClFN4O6S3 |
| Molecular Weight | 653.18 g/mol |
| Exact Mass | 652.07 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-1-(2,2-dioxodithiolan-3-yl)methanesulfonamide |
| SMILES | CCOc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1NS(=O)(=O)CC1CCSS1(=O)=O |
| InChI | InChI=1S/C27H26ClFN4O6S3/c1-2-38-26-13-23-21(12-24(26)33-41(34,35)15-20-8-9-40-42(20,36)37)27(31-16-30-23)32-19-6-7-25(22(28)11-19)39-14-17-4-3-5-18(29)10-17/h3-7,10-13,16,20,33H,2,8-9,14-15H2,1H3,(H,30,31,32) |
| InChIKey | SDNNBMQPRZWYBP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.18 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|