C21H16BClFN3O3 — CID 21071164
[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]boronic acid (PubChem CID 21071164) has the molecular formula C21H16BClFN3O3 and a molecular weight of 423.64 g/mol. Its IUPAC name is [4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]boronic acid.
| Compound Name | [4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]boronic acid |
|---|---|
| PubChem CID | 21071164 |
| Molecular Formula | C21H16BClFN3O3 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | [4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]boronic acid |
| SMILES | OB(O)c1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C21H16BClFN3O3/c23-18-10-16(5-7-20(18)30-11-13-2-1-3-15(24)8-13)27-21-17-9-14(22(28)29)4-6-19(17)25-12-26-21/h1-10,12,28-29H,11H2,(H,25,26,27) |
| InChIKey | AMIPECRUOOTPJR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|