C25H22ClFN4O2 — CID 11856291
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[(E)-propan-2-yloxyiminomethyl]quinazolin-4-amine (PubChem CID 11856291) has the molecular formula C25H22ClFN4O2 and a molecular weight of 464.93 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[(E)-propan-2-yloxyiminomethyl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[(E)-propan-2-yloxyiminomethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 11856291 |
| Molecular Formula | C25H22ClFN4O2 |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[(E)-propan-2-yloxyiminomethyl]quinazolin-4-amine |
| SMILES | CC(C)O/N=C/c1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C25H22ClFN4O2/c1-16(2)33-30-13-17-6-8-23-21(11-17)25(29-15-28-23)31-20-7-9-24(22(26)12-20)32-14-18-4-3-5-19(27)10-18/h3-13,15-16H,14H2,1-2H3,(H,28,29,31)/b30-13+ |
| InChIKey | MRTAGLMKQMKBGO-VVEOGCPPSA-N |
| XLogP | 6.50 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|