C34H29ClFN3O3 — CID 68905163
tert-butyl 3-[4-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]phenyl]prop-2-enoate (PubChem CID 68905163) has the molecular formula C34H29ClFN3O3 and a molecular weight of 582.08 g/mol. Its IUPAC name is tert-butyl 3-[4-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 68905163 |
| Molecular Formula | C34H29ClFN3O3 |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | tert-butyl 3-[4-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]phenyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=Cc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)cc1 |
| InChI | InChI=1S/C34H29ClFN3O3/c1-34(2,3)42-32(40)16-9-22-7-10-24(11-8-22)25-12-14-30-28(18-25)33(38-21-37-30)39-27-13-15-31(29(35)19-27)41-20-23-5-4-6-26(36)17-23/h4-19,21H,20H2,1-3H3,(H,37,38,39) |
| InChIKey | BJLDDGBJPVOLCB-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|