C35H30ClFN4O4 — CID 75306844
3-[3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 75306844) has the molecular formula C35H30ClFN4O4 and a molecular weight of 625.10 g/mol. Its IUPAC name is 3-[3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | 3-[3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 75306844 |
| Molecular Formula | C35H30ClFN4O4 |
| Molecular Weight | 625.10 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 3-[3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]phenyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C35H30ClFN4O4/c36-30-20-28(12-14-32(30)44-21-24-6-4-8-27(37)18-24)40-35-29-19-26(11-13-31(29)38-22-39-35)25-7-3-5-23(17-25)10-15-33(42)41-45-34-9-1-2-16-43-34/h3-8,10-15,17-20,22,34H,1-2,9,16,21H2,(H,41,42)(H,38,39,40) |
| InChIKey | XIKOZUOHFIAVNV-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.10 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|