C26H25ClFN5O2 — CID 90965840
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-(ethylamino)ethoxyiminomethyl]quinazolin-4-amine (PubChem CID 90965840) has the molecular formula C26H25ClFN5O2 and a molecular weight of 493.97 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-(ethylamino)ethoxyiminomethyl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-(ethylamino)ethoxyiminomethyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 90965840 |
| Molecular Formula | C26H25ClFN5O2 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[2-(ethylamino)ethoxyiminomethyl]quinazolin-4-amine |
| SMILES | CCNCCON=Cc1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C26H25ClFN5O2/c1-2-29-10-11-35-32-15-18-6-8-24-22(13-18)26(31-17-30-24)33-21-7-9-25(23(27)14-21)34-16-19-4-3-5-20(28)12-19/h3-9,12-15,17,29H,2,10-11,16H2,1H3,(H,30,31,33) |
| InChIKey | MOTZFHYHFJHPTM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|