C25H25ClFN5O2 — CID 91302522
4-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-N-[2-(ethylamino)ethoxy]quinazoline-4,6-diamine (PubChem CID 91302522) has the molecular formula C25H25ClFN5O2 and a molecular weight of 481.96 g/mol. Its IUPAC name is 4-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-N-[2-(ethylamino)ethoxy]quinazoline-4,6-diamine.
| Compound Name | 4-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-N-[2-(ethylamino)ethoxy]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 91302522 |
| Molecular Formula | C25H25ClFN5O2 |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 4-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-N-[2-(ethylamino)ethoxy]quinazoline-4,6-diamine |
| SMILES | CCNCCONc1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C25H25ClFN5O2/c1-2-28-10-11-34-32-20-6-8-23-21(13-20)25(30-16-29-23)31-19-7-9-24(22(26)14-19)33-15-17-4-3-5-18(27)12-17/h3-9,12-14,16,28,32H,2,10-11,15H2,1H3,(H,29,30,31) |
| InChIKey | QNMUEUUMUJEPPM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|