C21H17ClFN5O — CID 141177104
4-[2-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]hydrazinyl]quinazolin-6-amine (PubChem CID 141177104) has the molecular formula C21H17ClFN5O and a molecular weight of 409.85 g/mol. Its IUPAC name is 4-[2-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]hydrazinyl]quinazolin-6-amine.
| Compound Name | 4-[2-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]hydrazinyl]quinazolin-6-amine |
|---|---|
| PubChem CID | 141177104 |
| Molecular Formula | C21H17ClFN5O |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-[2-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]hydrazinyl]quinazolin-6-amine |
| SMILES | Nc1ccc2ncnc(NNc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C21H17ClFN5O/c22-18-10-16(5-7-20(18)29-11-13-2-1-3-14(23)8-13)27-28-21-17-9-15(24)4-6-19(17)25-12-26-21/h1-10,12,27H,11,24H2,(H,25,26,28) |
| InChIKey | MMCVMHCXRVGMQA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|