C20H16ClN5O — CID 69221072
4-N-[3-chloro-4-(pyridin-4-ylmethoxy)phenyl]quinazoline-4,6-diamine (PubChem CID 69221072) has the molecular formula C20H16ClN5O and a molecular weight of 377.84 g/mol. Its IUPAC name is 4-N-[3-chloro-4-(pyridin-4-ylmethoxy)phenyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[3-chloro-4-(pyridin-4-ylmethoxy)phenyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 69221072 |
| Molecular Formula | C20H16ClN5O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 4-N-[3-chloro-4-(pyridin-4-ylmethoxy)phenyl]quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3ccc(OCc4ccncc4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C20H16ClN5O/c21-17-10-15(2-4-19(17)27-11-13-5-7-23-8-6-13)26-20-16-9-14(22)1-3-18(16)24-12-25-20/h1-10,12H,11,22H2,(H,24,25,26) |
| InChIKey | DEFOXBZUVYUYCE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|