C17H18N4 — CID 64589074
4-N-(4-propylphenyl)quinazoline-4,6-diamine (PubChem CID 64589074) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-N-(4-propylphenyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(4-propylphenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 64589074 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 4-N-(4-propylphenyl)quinazoline-4,6-diamine |
| SMILES | CCCc1ccc(Nc2ncnc3ccc(N)cc23)cc1 |
| InChI | InChI=1S/C17H18N4/c1-2-3-12-4-7-14(8-5-12)21-17-15-10-13(18)6-9-16(15)19-11-20-17/h4-11H,2-3,18H2,1H3,(H,19,20,21) |
| InChIKey | UZFMKMGERQQTTA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|