C11H16N4 — CID 91218753
ethane;4-N-methylquinazoline-4,6-diamine (PubChem CID 91218753) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is ethane;4-N-methylquinazoline-4,6-diamine.
| Compound Name | ethane;4-N-methylquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 91218753 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | ethane;4-N-methylquinazoline-4,6-diamine |
| SMILES | CC.CNc1ncnc2ccc(N)cc12 |
| InChI | InChI=1S/C9H10N4.C2H6/c1-11-9-7-4-6(10)2-3-8(7)12-5-13-9;1-2/h2-5H,10H2,1H3,(H,11,12,13);1-2H3 |
| InChIKey | YNCCWIOOBYJILS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|