C20H24N6O — CID 141333726
N-[4-[(6-aminoquinazolin-4-yl)amino]phenyl]-2-(diethylamino)acetamide (PubChem CID 141333726) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[4-[(6-aminoquinazolin-4-yl)amino]phenyl]-2-(diethylamino)acetamide.
| Compound Name | N-[4-[(6-aminoquinazolin-4-yl)amino]phenyl]-2-(diethylamino)acetamide |
|---|---|
| PubChem CID | 141333726 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | N-[4-[(6-aminoquinazolin-4-yl)amino]phenyl]-2-(diethylamino)acetamide |
| SMILES | CCN(CC)CC(=O)Nc1ccc(Nc2ncnc3ccc(N)cc23)cc1 |
| InChI | InChI=1S/C20H24N6O/c1-3-26(4-2)12-19(27)24-15-6-8-16(9-7-15)25-20-17-11-14(21)5-10-18(17)22-13-23-20/h5-11,13H,3-4,12,21H2,1-2H3,(H,24,27)(H,22,23,25) |
| InChIKey | RICSPMYMLKVGFQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|