C16H13N5 — CID 64589511
2-[4-[(6-aminoquinazolin-4-yl)amino]phenyl]acetonitrile (PubChem CID 64589511) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[4-[(6-aminoquinazolin-4-yl)amino]phenyl]acetonitrile.
| Compound Name | 2-[4-[(6-aminoquinazolin-4-yl)amino]phenyl]acetonitrile |
|---|---|
| PubChem CID | 64589511 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[4-[(6-aminoquinazolin-4-yl)amino]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(Nc2ncnc3ccc(N)cc23)cc1 |
| InChI | InChI=1S/C16H13N5/c17-8-7-11-1-4-13(5-2-11)21-16-14-9-12(18)3-6-15(14)19-10-20-16/h1-6,9-10H,7,18H2,(H,19,20,21) |
| InChIKey | KTWPNASMCRDBGA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|