C14H11Cl2FN4 — CID 21217673
4-N-(3-chloro-4-fluorophenyl)quinazoline-4,6-diamine;hydrochloride (PubChem CID 21217673) has the molecular formula C14H11Cl2FN4 and a molecular weight of 325.17 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)quinazoline-4,6-diamine;hydrochloride.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)quinazoline-4,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 21217673 |
| Molecular Formula | C14H11Cl2FN4 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)quinazoline-4,6-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc2ncnc(Nc3ccc(F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C14H10ClFN4.ClH/c15-11-6-9(2-3-12(11)16)20-14-10-5-8(17)1-4-13(10)18-7-19-14;/h1-7H,17H2,(H,18,19,20);1H |
| InChIKey | QZNPZROGUZBQTQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|