C20H13ClFN3Se — CID 88532585
N-(3-chloro-4-fluorophenyl)-6-phenylselanylquinazolin-4-amine (PubChem CID 88532585) has the molecular formula C20H13ClFN3Se and a molecular weight of 428.76 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-phenylselanylquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-phenylselanylquinazolin-4-amine |
|---|---|
| PubChem CID | 88532585 |
| Molecular Formula | C20H13ClFN3Se |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.99 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-phenylselanylquinazolin-4-amine |
| SMILES | Fc1ccc(Nc2ncnc3ccc([Se]c4ccccc4)cc23)cc1Cl |
| InChI | InChI=1S/C20H13ClFN3Se/c21-17-10-13(6-8-18(17)22)25-20-16-11-15(7-9-19(16)23-12-24-20)26-14-4-2-1-3-5-14/h1-12H,(H,23,24,25) |
| InChIKey | LKLYAYRDCBVKMM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|