C29H30ClN7O3 — CID 54043765
N'-[4-[3-chloro-4-(pyridin-4-ylmethoxy)anilino]quinazolin-6-yl]-N-[3-(dimethylamino)propyl]but-2-enediamide (PubChem CID 54043765) has the molecular formula C29H30ClN7O3 and a molecular weight of 560.06 g/mol. Its IUPAC name is N'-[4-[3-chloro-4-(pyridin-4-ylmethoxy)anilino]quinazolin-6-yl]-N-[3-(dimethylamino)propyl]but-2-enediamide.
| Compound Name | N'-[4-[3-chloro-4-(pyridin-4-ylmethoxy)anilino]quinazolin-6-yl]-N-[3-(dimethylamino)propyl]but-2-enediamide |
|---|---|
| PubChem CID | 54043765 |
| Molecular Formula | C29H30ClN7O3 |
| Molecular Weight | 560.06 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | N'-[4-[3-chloro-4-(pyridin-4-ylmethoxy)anilino]quinazolin-6-yl]-N-[3-(dimethylamino)propyl]but-2-enediamide |
| SMILES | CN(C)CCCNC(=O)C=CC(=O)Nc1ccc2ncnc(Nc3ccc(OCc4ccncc4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C29H30ClN7O3/c1-37(2)15-3-12-32-27(38)8-9-28(39)35-21-4-6-25-23(16-21)29(34-19-33-25)36-22-5-7-26(24(30)17-22)40-18-20-10-13-31-14-11-20/h4-11,13-14,16-17,19H,3,12,15,18H2,1-2H3,(H,32,38)(H,35,39)(H,33,34,36) |
| InChIKey | LODKSKHHWFXCDX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.06 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|