C28H29ClN6O4S — CID 50939980
(E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl]-4-[methyl(2-methylsulfonylethyl)amino]but-2-enamide (PubChem CID 50939980) has the molecular formula C28H29ClN6O4S and a molecular weight of 581.10 g/mol. Its IUPAC name is (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl]-4-[methyl(2-methylsulfonylethyl)amino]but-2-enamide.
| Compound Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl]-4-[methyl(2-methylsulfonylethyl)amino]but-2-enamide |
|---|---|
| PubChem CID | 50939980 |
| Molecular Formula | C28H29ClN6O4S |
| Molecular Weight | 581.10 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | (E)-N-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]quinazolin-6-yl]-4-[methyl(2-methylsulfonylethyl)amino]but-2-enamide |
| SMILES | CN(C/C=C/C(=O)Nc1ccc2ncnc(Nc3ccc(OCc4ccccn4)c(Cl)c3)c2c1)CCS(C)(=O)=O |
| InChI | InChI=1S/C28H29ClN6O4S/c1-35(14-15-40(2,37)38)13-5-7-27(36)33-20-8-10-25-23(16-20)28(32-19-31-25)34-21-9-11-26(24(29)17-21)39-18-22-6-3-4-12-30-22/h3-12,16-17,19H,13-15,18H2,1-2H3,(H,33,36)(H,31,32,34)/b7-5+ |
| InChIKey | UZDADYYMILSEOL-FNORWQNLSA-N |
| XLogP | 4.47 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.10 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|