C26H25ClN8O3S — CID 54342926
N'-[4-[3-chloro-4-(1,3-thiazole-2-carbonyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]-N-[3-(dimethylamino)propyl]but-2-enediamide (PubChem CID 54342926) has the molecular formula C26H25ClN8O3S and a molecular weight of 565.06 g/mol. Its IUPAC name is N'-[4-[3-chloro-4-(1,3-thiazole-2-carbonyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]-N-[3-(dimethylamino)propyl]but-2-enediamide.
| Compound Name | N'-[4-[3-chloro-4-(1,3-thiazole-2-carbonyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]-N-[3-(dimethylamino)propyl]but-2-enediamide |
|---|---|
| PubChem CID | 54342926 |
| Molecular Formula | C26H25ClN8O3S |
| Molecular Weight | 565.06 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | N'-[4-[3-chloro-4-(1,3-thiazole-2-carbonyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]-N-[3-(dimethylamino)propyl]but-2-enediamide |
| SMILES | CN(C)CCCNC(=O)C=CC(=O)Nc1cc2c(Nc3ccc(C(=O)c4nccs4)c(Cl)c3)ncnc2cn1 |
| InChI | InChI=1S/C26H25ClN8O3S/c1-35(2)10-3-8-28-22(36)6-7-23(37)34-21-13-18-20(14-30-21)31-15-32-25(18)33-16-4-5-17(19(27)12-16)24(38)26-29-9-11-39-26/h4-7,9,11-15H,3,8,10H2,1-2H3,(H,28,36)(H,30,34,37)(H,31,32,33) |
| InChIKey | UAGDPYPSSLJGSO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 142.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.06 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|