C23H21N5OS — CID 54007809
N-[4-[3-methyl-4-(thiophen-3-ylmethyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]but-2-enamide (PubChem CID 54007809) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[4-[3-methyl-4-(thiophen-3-ylmethyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]but-2-enamide.
| Compound Name | N-[4-[3-methyl-4-(thiophen-3-ylmethyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 54007809 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[4-[3-methyl-4-(thiophen-3-ylmethyl)anilino]pyrido[3,4-d]pyrimidin-6-yl]but-2-enamide |
| SMILES | CC=CC(=O)Nc1cc2c(Nc3ccc(Cc4ccsc4)c(C)c3)ncnc2cn1 |
| InChI | InChI=1S/C23H21N5OS/c1-3-4-22(29)28-21-11-19-20(12-24-21)25-14-26-23(19)27-18-6-5-17(15(2)9-18)10-16-7-8-30-13-16/h3-9,11-14H,10H2,1-2H3,(H,24,28,29)(H,25,26,27) |
| InChIKey | KQCWTFVEBADGOC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|