C20H21FN6O — CID 91280354
4-(dimethylamino)-N-[4-(4-fluoro-3-methylanilino)pyrido[3,4-d]pyrimidin-6-yl]but-2-enamide (PubChem CID 91280354) has the molecular formula C20H21FN6O and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[4-(4-fluoro-3-methylanilino)pyrido[3,4-d]pyrimidin-6-yl]but-2-enamide.
| Compound Name | 4-(dimethylamino)-N-[4-(4-fluoro-3-methylanilino)pyrido[3,4-d]pyrimidin-6-yl]but-2-enamide |
|---|---|
| PubChem CID | 91280354 |
| Molecular Formula | C20H21FN6O |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-(dimethylamino)-N-[4-(4-fluoro-3-methylanilino)pyrido[3,4-d]pyrimidin-6-yl]but-2-enamide |
| SMILES | Cc1cc(Nc2ncnc3cnc(NC(=O)C=CCN(C)C)cc23)ccc1F |
| InChI | InChI=1S/C20H21FN6O/c1-13-9-14(6-7-16(13)21)25-20-15-10-18(22-11-17(15)23-12-24-20)26-19(28)5-4-8-27(2)3/h4-7,9-12H,8H2,1-3H3,(H,22,26,28)(H,23,24,25) |
| InChIKey | PJNIVAGWIBZGAY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|