C20H20BN5O — CID 88567720
CID 88567720 (PubChem CID 88567720) has the molecular formula C20H20BN5O and a molecular weight of 357.23 g/mol.
| Compound Name | CID 88567720 |
|---|---|
| PubChem CID | 88567720 |
| Molecular Formula | C20H20BN5O |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(Nc2ncnc3ccc(NC(=O)/C=C/CN(C)C)cc23)c1 |
| InChI | InChI=1S/C20H20BN5O/c1-26(2)10-4-7-19(27)24-16-8-9-18-17(12-16)20(23-13-22-18)25-15-6-3-5-14(21)11-15/h3-9,11-13H,10H2,1-2H3,(H,24,27)(H,22,23,25)/b7-4+ |
| InChIKey | NVJPBSBYWWUBEQ-QPJJXVBHSA-N |
| XLogP | 2.22 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|