C23H24BrN5O3 — CID 54202462
ethyl 2-[[4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate (PubChem CID 54202462) has the molecular formula C23H24BrN5O3 and a molecular weight of 498.38 g/mol. Its IUPAC name is ethyl 2-[[4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
|---|---|
| PubChem CID | 54202462 |
| Molecular Formula | C23H24BrN5O3 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | ethyl 2-[[4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)CC=CC(=O)Nc1ccc2ncnc(Nc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C23H24BrN5O3/c1-3-32-22(31)14-29(2)11-5-8-21(30)27-18-9-10-20-19(13-18)23(26-15-25-20)28-17-7-4-6-16(24)12-17/h4-10,12-13,15H,3,11,14H2,1-2H3,(H,27,30)(H,25,26,28) |
| InChIKey | PQFBMYDNUKQCCE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|