C26H28BrN5O4 — CID 54148841
cyclopropylmethyl 2-[[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate (PubChem CID 54148841) has the molecular formula C26H28BrN5O4 and a molecular weight of 554.45 g/mol. Its IUPAC name is cyclopropylmethyl 2-[[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate.
| Compound Name | cyclopropylmethyl 2-[[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
|---|---|
| PubChem CID | 54148841 |
| Molecular Formula | C26H28BrN5O4 |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | cyclopropylmethyl 2-[[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
| SMILES | COc1cc2ncnc(Nc3cccc(Br)c3)c2cc1NC(=O)C=CCN(C)CC(=O)OCC1CC1 |
| InChI | InChI=1S/C26H28BrN5O4/c1-32(14-25(34)36-15-17-8-9-17)10-4-7-24(33)31-22-12-20-21(13-23(22)35-2)28-16-29-26(20)30-19-6-3-5-18(27)11-19/h3-7,11-13,16-17H,8-10,14-15H2,1-2H3,(H,31,33)(H,28,29,30) |
| InChIKey | OGHQHNCWNFGXPL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|