C25H28BrN5O4 — CID 70206753
propyl 2-[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]but-2-enoyl-methylamino]acetate (PubChem CID 70206753) has the molecular formula C25H28BrN5O4 and a molecular weight of 542.43 g/mol. Its IUPAC name is propyl 2-[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]but-2-enoyl-methylamino]acetate.
| Compound Name | propyl 2-[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]but-2-enoyl-methylamino]acetate |
|---|---|
| PubChem CID | 70206753 |
| Molecular Formula | C25H28BrN5O4 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | propyl 2-[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]but-2-enoyl-methylamino]acetate |
| SMILES | CCCOC(=O)CN(C)C(=O)C=CCNc1cc2c(Nc3cccc(Br)c3)ncnc2cc1OC |
| InChI | InChI=1S/C25H28BrN5O4/c1-4-11-35-24(33)15-31(2)23(32)9-6-10-27-21-13-19-20(14-22(21)34-3)28-16-29-25(19)30-18-8-5-7-17(26)12-18/h5-9,12-14,16,27H,4,10-11,15H2,1-3H3,(H,28,29,30) |
| InChIKey | HWMUXVNSUIUJHW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|