C26H29BrN6O5 — CID 22269988
methyl 2-[3-[[(E)-4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl-methylamino]acetate (PubChem CID 22269988) has the molecular formula C26H29BrN6O5 and a molecular weight of 585.46 g/mol. Its IUPAC name is methyl 2-[3-[[(E)-4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl-methylamino]acetate.
| Compound Name | methyl 2-[3-[[(E)-4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl-methylamino]acetate |
|---|---|
| PubChem CID | 22269988 |
| Molecular Formula | C26H29BrN6O5 |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | methyl 2-[3-[[(E)-4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl-methylamino]acetate |
| SMILES | COC(=O)CN(C)CCCNC(=O)/C=C/C(=O)Nc1cc2c(Nc3cccc(Br)c3)ncnc2cc1OC |
| InChI | InChI=1S/C26H29BrN6O5/c1-33(15-25(36)38-3)11-5-10-28-23(34)8-9-24(35)32-21-13-19-20(14-22(21)37-2)29-16-30-26(19)31-18-7-4-6-17(27)12-18/h4,6-9,12-14,16H,5,10-11,15H2,1-3H3,(H,28,34)(H,32,35)(H,29,30,31)/b9-8+ |
| InChIKey | VUBHKUSYFXMYSI-CMDGGOBGSA-N |
| XLogP | 3.25 |
| TPSA | 134.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|