C32H35BrN6O7 — CID 67024648
ethyl 2-[3-[[4-[[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl-(2-ethoxy-2-oxoethyl)amino]acetate (PubChem CID 67024648) has the molecular formula C32H35BrN6O7 and a molecular weight of 695.57 g/mol. Its IUPAC name is ethyl 2-[3-[[4-[[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl-(2-ethoxy-2-oxoethyl)amino]acetate.
| Compound Name | ethyl 2-[3-[[4-[[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl-(2-ethoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 67024648 |
| Molecular Formula | C32H35BrN6O7 |
| Molecular Weight | 695.57 g/mol |
| Exact Mass | 694.18 |
| IUPAC Name | ethyl 2-[3-[[4-[[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]amino]-4-oxobut-2-enoyl]amino]propyl-(2-ethoxy-2-oxoethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCCNC(=O)C=CC(=O)Nc1cc2c(Nc3cccc(Br)c3)c(C#N)cnc2cc1OC)CC(=O)OCC |
| InChI | InChI=1S/C32H35BrN6O7/c1-4-45-30(42)19-39(20-31(43)46-5-2)13-7-12-35-28(40)10-11-29(41)38-26-15-24-25(16-27(26)44-3)36-18-21(17-34)32(24)37-23-9-6-8-22(33)14-23/h6,8-11,14-16,18H,4-5,7,12-13,19-20H2,1-3H3,(H,35,40)(H,36,37)(H,38,41) |
| InChIKey | DTEDAWZUKAGPAQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 171.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|