C25H24BrN5O3 — CID 54365575
ethyl 2-[[4-[[4-(3-bromoanilino)-3-cyanoquinolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate (PubChem CID 54365575) has the molecular formula C25H24BrN5O3 and a molecular weight of 522.40 g/mol. Its IUPAC name is ethyl 2-[[4-[[4-(3-bromoanilino)-3-cyanoquinolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[4-[[4-(3-bromoanilino)-3-cyanoquinolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
|---|---|
| PubChem CID | 54365575 |
| Molecular Formula | C25H24BrN5O3 |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | ethyl 2-[[4-[[4-(3-bromoanilino)-3-cyanoquinolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)CC=CC(=O)Nc1ccc2ncc(C#N)c(Nc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C25H24BrN5O3/c1-3-34-24(33)16-31(2)11-5-8-23(32)29-20-9-10-22-21(13-20)25(17(14-27)15-28-22)30-19-7-4-6-18(26)12-19/h4-10,12-13,15H,3,11,16H2,1-2H3,(H,28,30)(H,29,32) |
| InChIKey | UPNOBGDLKMEMDK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|