C25H26BrN5O2 — CID 54274159
N-[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]-4-(diethylamino)but-2-enamide (PubChem CID 54274159) has the molecular formula C25H26BrN5O2 and a molecular weight of 508.42 g/mol. Its IUPAC name is N-[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]-4-(diethylamino)but-2-enamide.
| Compound Name | N-[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]-4-(diethylamino)but-2-enamide |
|---|---|
| PubChem CID | 54274159 |
| Molecular Formula | C25H26BrN5O2 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | N-[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]-4-(diethylamino)but-2-enamide |
| SMILES | CCN(CC)CC=CC(=O)Nc1cc2c(Nc3cccc(Br)c3)c(C#N)cnc2cc1OC |
| InChI | InChI=1S/C25H26BrN5O2/c1-4-31(5-2)11-7-10-24(32)30-22-13-20-21(14-23(22)33-3)28-16-17(15-27)25(20)29-19-9-6-8-18(26)12-19/h6-10,12-14,16H,4-5,11H2,1-3H3,(H,28,29)(H,30,32) |
| InChIKey | RMFYQLUHNZPYCP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|