C26H26BrN5O4 — CID 22270208
ethyl 2-[[(E)-4-[[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate (PubChem CID 22270208) has the molecular formula C26H26BrN5O4 and a molecular weight of 552.43 g/mol. Its IUPAC name is ethyl 2-[[(E)-4-[[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[(E)-4-[[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
|---|---|
| PubChem CID | 22270208 |
| Molecular Formula | C26H26BrN5O4 |
| Molecular Weight | 552.43 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | ethyl 2-[[(E)-4-[[4-(3-bromoanilino)-3-cyano-7-methoxyquinolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C/C=C/C(=O)Nc1cc2c(Nc3cccc(Br)c3)c(C#N)cnc2cc1OC |
| InChI | InChI=1S/C26H26BrN5O4/c1-4-36-25(34)16-32(2)10-6-9-24(33)31-22-12-20-21(13-23(22)35-3)29-15-17(14-28)26(20)30-19-8-5-7-18(27)11-19/h5-9,11-13,15H,4,10,16H2,1-3H3,(H,29,30)(H,31,33)/b9-6+ |
| InChIKey | PTWLQZHADKDVMM-RMKNXTFCSA-N |
| XLogP | 4.61 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|