C25H29N5O4 — CID 67024464
ethyl 2-[[4-[[7-methoxy-4-(3-methylanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate (PubChem CID 67024464) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is ethyl 2-[[4-[[7-methoxy-4-(3-methylanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[4-[[7-methoxy-4-(3-methylanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
|---|---|
| PubChem CID | 67024464 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | ethyl 2-[[4-[[7-methoxy-4-(3-methylanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)CC=CC(=O)Nc1cc2c(Nc3cccc(C)c3)ncnc2cc1OC |
| InChI | InChI=1S/C25H29N5O4/c1-5-34-24(32)15-30(3)11-7-10-23(31)29-21-13-19-20(14-22(21)33-4)26-16-27-25(19)28-18-9-6-8-17(2)12-18/h6-10,12-14,16H,5,11,15H2,1-4H3,(H,29,31)(H,26,27,28) |
| InChIKey | PFFGFUUYDWQGJV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|