C25H26N6O4 — CID 22270063
ethyl 2-[[(E)-4-[[4-(3-cyanoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate (PubChem CID 22270063) has the molecular formula C25H26N6O4 and a molecular weight of 474.52 g/mol. Its IUPAC name is ethyl 2-[[(E)-4-[[4-(3-cyanoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate.
| Compound Name | ethyl 2-[[(E)-4-[[4-(3-cyanoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
|---|---|
| PubChem CID | 22270063 |
| Molecular Formula | C25H26N6O4 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | ethyl 2-[[(E)-4-[[4-(3-cyanoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)C/C=C/C(=O)Nc1cc2c(Nc3cccc(C#N)c3)ncnc2cc1OC |
| InChI | InChI=1S/C25H26N6O4/c1-4-35-24(33)15-31(2)10-6-9-23(32)30-21-12-19-20(13-22(21)34-3)27-16-28-25(19)29-18-8-5-7-17(11-18)14-26/h5-9,11-13,16H,4,10,15H2,1-3H3,(H,30,32)(H,27,28,29)/b9-6+ |
| InChIKey | PVPDMZSNHVZDSB-RMKNXTFCSA-N |
| XLogP | 3.24 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|