C25H26BrN5O4 — CID 22269934
ethyl 3-[[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-ynyl]-methylamino]propanoate (PubChem CID 22269934) has the molecular formula C25H26BrN5O4 and a molecular weight of 540.42 g/mol. Its IUPAC name is ethyl 3-[[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-ynyl]-methylamino]propanoate.
| Compound Name | ethyl 3-[[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-ynyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 22269934 |
| Molecular Formula | C25H26BrN5O4 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | ethyl 3-[[4-[[4-(3-bromoanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-ynyl]-methylamino]propanoate |
| SMILES | CCOC(=O)CCN(C)CC#CC(=O)Nc1cc2c(Nc3cccc(Br)c3)ncnc2cc1OC |
| InChI | InChI=1S/C25H26BrN5O4/c1-4-35-24(33)10-12-31(2)11-6-9-23(32)30-21-14-19-20(15-22(21)34-3)27-16-28-25(19)29-18-8-5-7-17(26)13-18/h5,7-8,13-16H,4,10-12H2,1-3H3,(H,30,32)(H,27,28,29) |
| InChIKey | UOCBOEMDTWNKHS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|