C23H26BrN5O5 — CID 22270003
ethyl 2-[4-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxybutyl-methylamino]acetate (PubChem CID 22270003) has the molecular formula C23H26BrN5O5 and a molecular weight of 532.40 g/mol. Its IUPAC name is ethyl 2-[4-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxybutyl-methylamino]acetate.
| Compound Name | ethyl 2-[4-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxybutyl-methylamino]acetate |
|---|---|
| PubChem CID | 22270003 |
| Molecular Formula | C23H26BrN5O5 |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | ethyl 2-[4-[4-(3-bromoanilino)-6-nitroquinazolin-7-yl]oxybutyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)CCCCOc1cc2ncnc(Nc3cccc(Br)c3)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H26BrN5O5/c1-3-33-22(30)14-28(2)9-4-5-10-34-21-13-19-18(12-20(21)29(31)32)23(26-15-25-19)27-17-8-6-7-16(24)11-17/h6-8,11-13,15H,3-5,9-10,14H2,1-2H3,(H,25,26,27) |
| InChIKey | ZEHQFUPWMTXAHS-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|