C20H23BrN4O — CID 140994402
N-(3-bromophenyl)-7-[4-(dimethylamino)butoxy]quinazolin-4-amine (PubChem CID 140994402) has the molecular formula C20H23BrN4O and a molecular weight of 415.34 g/mol. Its IUPAC name is N-(3-bromophenyl)-7-[4-(dimethylamino)butoxy]quinazolin-4-amine.
| Compound Name | N-(3-bromophenyl)-7-[4-(dimethylamino)butoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 140994402 |
| Molecular Formula | C20H23BrN4O |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-(3-bromophenyl)-7-[4-(dimethylamino)butoxy]quinazolin-4-amine |
| SMILES | CN(C)CCCCOc1ccc2c(Nc3cccc(Br)c3)ncnc2c1 |
| InChI | InChI=1S/C20H23BrN4O/c1-25(2)10-3-4-11-26-17-8-9-18-19(13-17)22-14-23-20(18)24-16-7-5-6-15(21)12-16/h5-9,12-14H,3-4,10-11H2,1-2H3,(H,22,23,24) |
| InChIKey | HQYGMGHYHHLLGZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|