C20H23BrCl2N5O3P — CID 71616700
6-[2-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxyethoxy]-N-(3-bromophenyl)quinazolin-4-amine (PubChem CID 71616700) has the molecular formula C20H23BrCl2N5O3P and a molecular weight of 563.22 g/mol. Its IUPAC name is 6-[2-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxyethoxy]-N-(3-bromophenyl)quinazolin-4-amine.
| Compound Name | 6-[2-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxyethoxy]-N-(3-bromophenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 71616700 |
| Molecular Formula | C20H23BrCl2N5O3P |
| Molecular Weight | 563.22 g/mol |
| Exact Mass | 561.01 |
| IUPAC Name | 6-[2-[amino-[bis(2-chloroethyl)amino]phosphoryl]oxyethoxy]-N-(3-bromophenyl)quinazolin-4-amine |
| SMILES | NP(=O)(OCCOc1ccc2ncnc(Nc3cccc(Br)c3)c2c1)N(CCCl)CCCl |
| InChI | InChI=1S/C20H23BrCl2N5O3P/c21-15-2-1-3-16(12-15)27-20-18-13-17(4-5-19(18)25-14-26-20)30-10-11-31-32(24,29)28(8-6-22)9-7-23/h1-5,12-14H,6-11H2,(H2,24,29)(H,25,26,27) |
| InChIKey | IFGRZKHRJZWZKC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.22 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|